C15H15BFN3O4 — CID 89010523
CID 89010523 (PubChem CID 89010523) has the molecular formula C15H15BFN3O4 and a molecular weight of 331.11 g/mol.
| Compound Name | CID 89010523 |
|---|---|
| PubChem CID | 89010523 |
| Molecular Formula | C15H15BFN3O4 |
| Molecular Weight | 331.11 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Nc2c(C(=O)NOCCO)ccc(=O)n2C)c(F)c1 |
| InChI | InChI=1S/C15H15BFN3O4/c1-20-13(22)5-3-10(15(23)19-24-7-6-21)14(20)18-12-4-2-9(16)8-11(12)17/h2-5,8,18,21H,6-7H2,1H3,(H,19,23) |
| InChIKey | IASSTKOCXZCBNR-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.11 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|