C19H12F12N2O3 — CID 23504099
3,4-difluoro-2-[2-fluoro-4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]anilino]-N-(2-hydroxyethoxy)benzamide (PubChem CID 23504099) has the molecular formula C19H12F12N2O3 and a molecular weight of 544.29 g/mol. Its IUPAC name is 3,4-difluoro-2-[2-fluoro-4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]anilino]-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 3,4-difluoro-2-[2-fluoro-4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]anilino]-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 23504099 |
| Molecular Formula | C19H12F12N2O3 |
| Molecular Weight | 544.29 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | 3,4-difluoro-2-[2-fluoro-4-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]anilino]-N-(2-hydroxyethoxy)benzamide |
| SMILES | O=C(NOCCO)c1ccc(F)c(F)c1Nc1ccc(C(C(F)(F)F)(C(F)(F)F)C(F)(F)F)cc1F |
| InChI | InChI=1S/C19H12F12N2O3/c20-10-3-2-9(15(35)33-36-6-5-34)14(13(10)22)32-12-4-1-8(7-11(12)21)16(17(23,24)25,18(26,27)28)19(29,30)31/h1-4,7,32,34H,5-6H2,(H,33,35) |
| InChIKey | UGZSSXOUHRTRPH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.29 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|