C18H18F2N2O5 — CID 150191045
ethyl 4-[2,3-difluoro-6-(2-hydroxyethoxycarbamoyl)anilino]benzoate (PubChem CID 150191045) has the molecular formula C18H18F2N2O5 and a molecular weight of 380.35 g/mol. Its IUPAC name is ethyl 4-[2,3-difluoro-6-(2-hydroxyethoxycarbamoyl)anilino]benzoate.
| Compound Name | ethyl 4-[2,3-difluoro-6-(2-hydroxyethoxycarbamoyl)anilino]benzoate |
|---|---|
| PubChem CID | 150191045 |
| Molecular Formula | C18H18F2N2O5 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | ethyl 4-[2,3-difluoro-6-(2-hydroxyethoxycarbamoyl)anilino]benzoate |
| SMILES | CCOC(=O)c1ccc(Nc2c(C(=O)NOCCO)ccc(F)c2F)cc1 |
| InChI | InChI=1S/C18H18F2N2O5/c1-2-26-18(25)11-3-5-12(6-4-11)21-16-13(7-8-14(19)15(16)20)17(24)22-27-10-9-23/h3-8,21,23H,2,9-10H2,1H3,(H,22,24) |
| InChIKey | FNLFYDAYAOZGOK-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|