C20H23F3N2O3 — CID 87923083
3,4-difluoro-2-[2-fluoro-4-[(2S)-2-methylbutyl]anilino]-N-(2-hydroxyethoxy)benzamide (PubChem CID 87923083) has the molecular formula C20H23F3N2O3 and a molecular weight of 396.41 g/mol. Its IUPAC name is 3,4-difluoro-2-[2-fluoro-4-[(2S)-2-methylbutyl]anilino]-N-(2-hydroxyethoxy)benzamide.
| Compound Name | 3,4-difluoro-2-[2-fluoro-4-[(2S)-2-methylbutyl]anilino]-N-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 87923083 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3,4-difluoro-2-[2-fluoro-4-[(2S)-2-methylbutyl]anilino]-N-(2-hydroxyethoxy)benzamide |
| SMILES | CC[C@H](C)Cc1ccc(Nc2c(C(=O)NOCCO)ccc(F)c2F)c(F)c1 |
| InChI | InChI=1S/C20H23F3N2O3/c1-3-12(2)10-13-4-7-17(16(22)11-13)24-19-14(5-6-15(21)18(19)23)20(27)25-28-9-8-26/h4-7,11-12,24,26H,3,8-10H2,1-2H3,(H,25,27)/t12-/m0/s1 |
| InChIKey | SXNOCNPMJQOUAD-LBPRGKRZSA-N |
| XLogP | 4.09 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|