C15H14BFN2O3 — CID 88870300
CID 88870300 (PubChem CID 88870300) has the molecular formula C15H14BFN2O3 and a molecular weight of 300.10 g/mol.
| Compound Name | CID 88870300 |
|---|---|
| PubChem CID | 88870300 |
| Molecular Formula | C15H14BFN2O3 |
| Molecular Weight | 300.10 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(Nc2c(C(=O)OC)cc(C)c(=O)n2C)c(F)c1 |
| InChI | InChI=1S/C15H14BFN2O3/c1-8-6-10(15(21)22-3)13(19(2)14(8)20)18-12-5-4-9(16)7-11(12)17/h4-7,18H,1-3H3 |
| InChIKey | RDAMXLUDUZTQCC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.10 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|