C19H22FIN4O5 — CID 89307323
2-[[2-(2-fluoro-4-iodoanilino)-1,5-dimethyl-6-oxopyridine-3-carbonyl]amino]oxyethyl (2S)-2-aminopropanoate (PubChem CID 89307323) has the molecular formula C19H22FIN4O5 and a molecular weight of 532.31 g/mol. Its IUPAC name is 2-[[2-(2-fluoro-4-iodoanilino)-1,5-dimethyl-6-oxopyridine-3-carbonyl]amino]oxyethyl (2S)-2-aminopropanoate.
| Compound Name | 2-[[2-(2-fluoro-4-iodoanilino)-1,5-dimethyl-6-oxopyridine-3-carbonyl]amino]oxyethyl (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 89307323 |
| Molecular Formula | C19H22FIN4O5 |
| Molecular Weight | 532.31 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | 2-[[2-(2-fluoro-4-iodoanilino)-1,5-dimethyl-6-oxopyridine-3-carbonyl]amino]oxyethyl (2S)-2-aminopropanoate |
| SMILES | Cc1cc(C(=O)NOCCOC(=O)[C@H](C)N)c(Nc2ccc(I)cc2F)n(C)c1=O |
| InChI | InChI=1S/C19H22FIN4O5/c1-10-8-13(17(26)24-30-7-6-29-19(28)11(2)22)16(25(3)18(10)27)23-15-5-4-12(21)9-14(15)20/h4-5,8-9,11,23H,6-7,22H2,1-3H3,(H,24,26)/t11-/m0/s1 |
| InChIKey | HZYHENVPIWCKRA-NSHDSACASA-N |
| XLogP | 1.73 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|