C17H20IN3O4 — CID 25189177
5-acetyl-N-(2-hydroxyethoxy)-2-(4-iodo-2-methylanilino)-1-methylpyrrole-3-carboxamide (PubChem CID 25189177) has the molecular formula C17H20IN3O4 and a molecular weight of 457.27 g/mol. Its IUPAC name is 5-acetyl-N-(2-hydroxyethoxy)-2-(4-iodo-2-methylanilino)-1-methylpyrrole-3-carboxamide.
| Compound Name | 5-acetyl-N-(2-hydroxyethoxy)-2-(4-iodo-2-methylanilino)-1-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 25189177 |
| Molecular Formula | C17H20IN3O4 |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 5-acetyl-N-(2-hydroxyethoxy)-2-(4-iodo-2-methylanilino)-1-methylpyrrole-3-carboxamide |
| SMILES | CC(=O)c1cc(C(=O)NOCCO)c(Nc2ccc(I)cc2C)n1C |
| InChI | InChI=1S/C17H20IN3O4/c1-10-8-12(18)4-5-14(10)19-16-13(17(24)20-25-7-6-22)9-15(11(2)23)21(16)3/h4-5,8-9,19,22H,6-7H2,1-3H3,(H,20,24) |
| InChIKey | RAKMHGVLHGCFNI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|