C18H22FN3O5 — CID 143666937
5-acetyl-N-(1,3-dihydroxypropan-2-yloxy)-2-(2-fluoro-4-methylanilino)-1-methylpyrrole-3-carboxamide (PubChem CID 143666937) has the molecular formula C18H22FN3O5 and a molecular weight of 379.39 g/mol. Its IUPAC name is 5-acetyl-N-(1,3-dihydroxypropan-2-yloxy)-2-(2-fluoro-4-methylanilino)-1-methylpyrrole-3-carboxamide.
| Compound Name | 5-acetyl-N-(1,3-dihydroxypropan-2-yloxy)-2-(2-fluoro-4-methylanilino)-1-methylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 143666937 |
| Molecular Formula | C18H22FN3O5 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 5-acetyl-N-(1,3-dihydroxypropan-2-yloxy)-2-(2-fluoro-4-methylanilino)-1-methylpyrrole-3-carboxamide |
| SMILES | CC(=O)c1cc(C(=O)NOC(CO)CO)c(Nc2ccc(C)cc2F)n1C |
| InChI | InChI=1S/C18H22FN3O5/c1-10-4-5-15(14(19)6-10)20-17-13(7-16(11(2)25)22(17)3)18(26)21-27-12(8-23)9-24/h4-7,12,20,23-24H,8-9H2,1-3H3,(H,21,26) |
| InChIKey | SNTDJIBAJBCPGC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|