C17H20ClFN2O3 — CID 143666924
5-acetyl-4-chloro-2-(2-fluoro-4-methylanilino)-1-methylpyrrole-3-carboxylic acid;ethane (PubChem CID 143666924) has the molecular formula C17H20ClFN2O3 and a molecular weight of 354.81 g/mol. Its IUPAC name is 5-acetyl-4-chloro-2-(2-fluoro-4-methylanilino)-1-methylpyrrole-3-carboxylic acid;ethane.
| Compound Name | 5-acetyl-4-chloro-2-(2-fluoro-4-methylanilino)-1-methylpyrrole-3-carboxylic acid;ethane |
|---|---|
| PubChem CID | 143666924 |
| Molecular Formula | C17H20ClFN2O3 |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 5-acetyl-4-chloro-2-(2-fluoro-4-methylanilino)-1-methylpyrrole-3-carboxylic acid;ethane |
| SMILES | CC.CC(=O)c1c(Cl)c(C(=O)O)c(Nc2ccc(C)cc2F)n1C |
| InChI | InChI=1S/C15H14ClFN2O3.C2H6/c1-7-4-5-10(9(17)6-7)18-14-11(15(21)22)12(16)13(8(2)20)19(14)3;1-2/h4-6,18H,1-3H3,(H,21,22);1-2H3 |
| InChIKey | NDJPMWGPXUPSSM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |