C15H13ClFN3O2 — CID 143414643
5-chloro-6-(ethenylamino)-4-(2-fluoro-4-methylanilino)pyridine-3-carboxylic acid (PubChem CID 143414643) has the molecular formula C15H13ClFN3O2 and a molecular weight of 321.74 g/mol. Its IUPAC name is 5-chloro-6-(ethenylamino)-4-(2-fluoro-4-methylanilino)pyridine-3-carboxylic acid.
| Compound Name | 5-chloro-6-(ethenylamino)-4-(2-fluoro-4-methylanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 143414643 |
| Molecular Formula | C15H13ClFN3O2 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 5-chloro-6-(ethenylamino)-4-(2-fluoro-4-methylanilino)pyridine-3-carboxylic acid |
| SMILES | C=CNc1ncc(C(=O)O)c(Nc2ccc(C)cc2F)c1Cl |
| InChI | InChI=1S/C15H13ClFN3O2/c1-3-18-14-12(16)13(9(7-19-14)15(21)22)20-11-5-4-8(2)6-10(11)17/h3-7H,1H2,2H3,(H,21,22)(H2,18,19,20) |
| InChIKey | LIIFFBICPGDUKS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |