C13H9Cl2FN2O2 — CID 118412477
5,6-dichloro-4-(4-fluoro-2-methylanilino)pyridine-3-carboxylic acid (PubChem CID 118412477) has the molecular formula C13H9Cl2FN2O2 and a molecular weight of 315.13 g/mol. Its IUPAC name is 5,6-dichloro-4-(4-fluoro-2-methylanilino)pyridine-3-carboxylic acid.
| Compound Name | 5,6-dichloro-4-(4-fluoro-2-methylanilino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 118412477 |
| Molecular Formula | C13H9Cl2FN2O2 |
| Molecular Weight | 315.13 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 5,6-dichloro-4-(4-fluoro-2-methylanilino)pyridine-3-carboxylic acid |
| SMILES | Cc1cc(F)ccc1Nc1c(C(=O)O)cnc(Cl)c1Cl |
| InChI | InChI=1S/C13H9Cl2FN2O2/c1-6-4-7(16)2-3-9(6)18-11-8(13(19)20)5-17-12(15)10(11)14/h2-5H,1H3,(H,17,18)(H,19,20) |
| InChIKey | OEOZUDWYTFTJED-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.13 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|