C17H21BrFN3O4 — CID 152808195
2-(4-bromo-2-fluoroanilino)-5-ethyl-N-(2-hydroxyethoxy)-1-methyl-6-oxo-2,3-dihydropyridine-3-carboxamide (PubChem CID 152808195) has the molecular formula C17H21BrFN3O4 and a molecular weight of 430.27 g/mol. Its IUPAC name is 2-(4-bromo-2-fluoroanilino)-5-ethyl-N-(2-hydroxyethoxy)-1-methyl-6-oxo-2,3-dihydropyridine-3-carboxamide.
| Compound Name | 2-(4-bromo-2-fluoroanilino)-5-ethyl-N-(2-hydroxyethoxy)-1-methyl-6-oxo-2,3-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 152808195 |
| Molecular Formula | C17H21BrFN3O4 |
| Molecular Weight | 430.27 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 2-(4-bromo-2-fluoroanilino)-5-ethyl-N-(2-hydroxyethoxy)-1-methyl-6-oxo-2,3-dihydropyridine-3-carboxamide |
| SMILES | CCC1=CC(C(=O)NOCCO)C(Nc2ccc(Br)cc2F)N(C)C1=O |
| InChI | InChI=1S/C17H21BrFN3O4/c1-3-10-8-12(16(24)21-26-7-6-23)15(22(2)17(10)25)20-14-5-4-11(18)9-13(14)19/h4-5,8-9,12,15,20,23H,3,6-7H2,1-2H3,(H,21,24) |
| InChIKey | SPXLPAFZWXJAKD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|