C16H19FIN3O4 — CID 154553691
2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1,5-dimethyl-6-oxo-2,3-dihydropyridine-3-carboxamide (PubChem CID 154553691) has the molecular formula C16H19FIN3O4 and a molecular weight of 463.25 g/mol. Its IUPAC name is 2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1,5-dimethyl-6-oxo-2,3-dihydropyridine-3-carboxamide.
| Compound Name | 2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1,5-dimethyl-6-oxo-2,3-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 154553691 |
| Molecular Formula | C16H19FIN3O4 |
| Molecular Weight | 463.25 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1,5-dimethyl-6-oxo-2,3-dihydropyridine-3-carboxamide |
| SMILES | CC1=CC(C(=O)NOCCO)C(Nc2ccc(I)cc2F)N(C)C1=O |
| InChI | InChI=1S/C16H19FIN3O4/c1-9-7-11(15(23)20-25-6-5-22)14(21(2)16(9)24)19-13-4-3-10(18)8-12(13)17/h3-4,7-8,11,14,19,22H,5-6H2,1-2H3,(H,20,23) |
| InChIKey | VJYXFXVTEJUAKX-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|