C17H19FIN5O3 — CID 89147864
(E)-4-(4,5-dimethyl-1,2,4-triazol-3-yl)-3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-2-methylidenebut-3-enamide (PubChem CID 89147864) has the molecular formula C17H19FIN5O3 and a molecular weight of 487.27 g/mol. Its IUPAC name is (E)-4-(4,5-dimethyl-1,2,4-triazol-3-yl)-3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-2-methylidenebut-3-enamide.
| Compound Name | (E)-4-(4,5-dimethyl-1,2,4-triazol-3-yl)-3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-2-methylidenebut-3-enamide |
|---|---|
| PubChem CID | 89147864 |
| Molecular Formula | C17H19FIN5O3 |
| Molecular Weight | 487.27 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | (E)-4-(4,5-dimethyl-1,2,4-triazol-3-yl)-3-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-2-methylidenebut-3-enamide |
| SMILES | C=C(C(=O)NOCCO)/C(=C\c1nnc(C)n1C)Nc1ccc(I)cc1F |
| InChI | InChI=1S/C17H19FIN5O3/c1-10(17(26)23-27-7-6-25)15(9-16-22-21-11(2)24(16)3)20-14-5-4-12(19)8-13(14)18/h4-5,8-9,20,25H,1,6-7H2,2-3H3,(H,23,26)/b15-9+ |
| InChIKey | OQPZRJNTUTUIGO-OQLLNIDSSA-N |
| XLogP | 1.92 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.27 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|