C15H15FIN3O2 — CID 89129472
1-[4-(1-aminoethenyl)-5-(2-fluoro-4-iodoanilino)-1-methylpyrrol-2-yl]-2-hydroxyethanone (PubChem CID 89129472) has the molecular formula C15H15FIN3O2 and a molecular weight of 415.21 g/mol. Its IUPAC name is 1-[4-(1-aminoethenyl)-5-(2-fluoro-4-iodoanilino)-1-methylpyrrol-2-yl]-2-hydroxyethanone.
| Compound Name | 1-[4-(1-aminoethenyl)-5-(2-fluoro-4-iodoanilino)-1-methylpyrrol-2-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 89129472 |
| Molecular Formula | C15H15FIN3O2 |
| Molecular Weight | 415.21 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 1-[4-(1-aminoethenyl)-5-(2-fluoro-4-iodoanilino)-1-methylpyrrol-2-yl]-2-hydroxyethanone |
| SMILES | C=C(N)c1cc(C(=O)CO)n(C)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C15H15FIN3O2/c1-8(18)10-6-13(14(22)7-21)20(2)15(10)19-12-4-3-9(17)5-11(12)16/h3-6,19,21H,1,7,18H2,2H3 |
| InChIKey | HGRPBMZRPIRTLJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|