C18H20FIN4O5 — CID 126592633
6-(2-fluoro-4-iodoanilino)-7-[(2-hydroxyethoxyamino)methoxymethyl]-2,5-dimethyl-[1,3]oxazolo[4,5-c]pyridin-4-one (PubChem CID 126592633) has the molecular formula C18H20FIN4O5 and a molecular weight of 518.28 g/mol. Its IUPAC name is 6-(2-fluoro-4-iodoanilino)-7-[(2-hydroxyethoxyamino)methoxymethyl]-2,5-dimethyl-[1,3]oxazolo[4,5-c]pyridin-4-one.
| Compound Name | 6-(2-fluoro-4-iodoanilino)-7-[(2-hydroxyethoxyamino)methoxymethyl]-2,5-dimethyl-[1,3]oxazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 126592633 |
| Molecular Formula | C18H20FIN4O5 |
| Molecular Weight | 518.28 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 6-(2-fluoro-4-iodoanilino)-7-[(2-hydroxyethoxyamino)methoxymethyl]-2,5-dimethyl-[1,3]oxazolo[4,5-c]pyridin-4-one |
| SMILES | Cc1nc2c(=O)n(C)c(Nc3ccc(I)cc3F)c(COCNOCCO)c2o1 |
| InChI | InChI=1S/C18H20FIN4O5/c1-10-22-15-16(29-10)12(8-27-9-21-28-6-5-25)17(24(2)18(15)26)23-14-4-3-11(20)7-13(14)19/h3-4,7,21,23,25H,5-6,8-9H2,1-2H3 |
| InChIKey | ZSAKYDQBOWIMMC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|