C19H23FIN3O3 — CID 143666929
1-[5-(2-fluoro-4-iodoanilino)-4-[2-(2-hydroxyethoxyamino)cyclopropyl]-1,3-dimethylpyrrol-2-yl]ethanone (PubChem CID 143666929) has the molecular formula C19H23FIN3O3 and a molecular weight of 487.31 g/mol. Its IUPAC name is 1-[5-(2-fluoro-4-iodoanilino)-4-[2-(2-hydroxyethoxyamino)cyclopropyl]-1,3-dimethylpyrrol-2-yl]ethanone.
| Compound Name | 1-[5-(2-fluoro-4-iodoanilino)-4-[2-(2-hydroxyethoxyamino)cyclopropyl]-1,3-dimethylpyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 143666929 |
| Molecular Formula | C19H23FIN3O3 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 487.08 |
| IUPAC Name | 1-[5-(2-fluoro-4-iodoanilino)-4-[2-(2-hydroxyethoxyamino)cyclopropyl]-1,3-dimethylpyrrol-2-yl]ethanone |
| SMILES | CC(=O)c1c(C)c(C2CC2NOCCO)c(Nc2ccc(I)cc2F)n1C |
| InChI | InChI=1S/C19H23FIN3O3/c1-10-17(13-9-16(13)23-27-7-6-25)19(24(3)18(10)11(2)26)22-15-5-4-12(21)8-14(15)20/h4-5,8,13,16,22-23,25H,6-7,9H2,1-3H3 |
| InChIKey | QOOUECHDPGSYIL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|