C17H19FIN3O4 — CID 90858470
N-acetyl-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1,4-dimethylpyrrole-3-carboxamide (PubChem CID 90858470) has the molecular formula C17H19FIN3O4 and a molecular weight of 475.26 g/mol. Its IUPAC name is N-acetyl-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1,4-dimethylpyrrole-3-carboxamide.
| Compound Name | N-acetyl-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1,4-dimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 90858470 |
| Molecular Formula | C17H19FIN3O4 |
| Molecular Weight | 475.26 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | N-acetyl-2-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1,4-dimethylpyrrole-3-carboxamide |
| SMILES | CC(=O)N(OCCO)C(=O)c1c(C)cn(C)c1Nc1ccc(I)cc1F |
| InChI | InChI=1S/C17H19FIN3O4/c1-10-9-21(3)16(20-14-5-4-12(19)8-13(14)18)15(10)17(25)22(11(2)24)26-7-6-23/h4-5,8-9,20,23H,6-7H2,1-3H3 |
| InChIKey | IJXLWVQXDVQYFX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|