C18H19BrF2N4O3 — CID 155220776
2-(4-bromo-2-fluoroanilino)-5-(dimethylamino)-3-fluoro-N-(2-hydroxyethoxy)-4-(methylideneamino)benzamide (PubChem CID 155220776) has the molecular formula C18H19BrF2N4O3 and a molecular weight of 457.28 g/mol. Its IUPAC name is 2-(4-bromo-2-fluoroanilino)-5-(dimethylamino)-3-fluoro-N-(2-hydroxyethoxy)-4-(methylideneamino)benzamide.
| Compound Name | 2-(4-bromo-2-fluoroanilino)-5-(dimethylamino)-3-fluoro-N-(2-hydroxyethoxy)-4-(methylideneamino)benzamide |
|---|---|
| PubChem CID | 155220776 |
| Molecular Formula | C18H19BrF2N4O3 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | 2-(4-bromo-2-fluoroanilino)-5-(dimethylamino)-3-fluoro-N-(2-hydroxyethoxy)-4-(methylideneamino)benzamide |
| SMILES | C=Nc1c(N(C)C)cc(C(=O)NOCCO)c(Nc2ccc(Br)cc2F)c1F |
| InChI | InChI=1S/C18H19BrF2N4O3/c1-22-17-14(25(2)3)9-11(18(27)24-28-7-6-26)16(15(17)21)23-13-5-4-10(19)8-12(13)20/h4-5,8-9,23,26H,1,6-7H2,2-3H3,(H,24,27) |
| InChIKey | BAPVPNXLELFPAU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|