C19H19BrFN3O4 — CID 88942623
6-(4-bromo-2-fluoroanilino)-N-(2-hydroxyethoxy)-3,3-dimethyl-1-oxo-2H-isoindole-5-carboxamide (PubChem CID 88942623) has the molecular formula C19H19BrFN3O4 and a molecular weight of 452.28 g/mol. Its IUPAC name is 6-(4-bromo-2-fluoroanilino)-N-(2-hydroxyethoxy)-3,3-dimethyl-1-oxo-2H-isoindole-5-carboxamide.
| Compound Name | 6-(4-bromo-2-fluoroanilino)-N-(2-hydroxyethoxy)-3,3-dimethyl-1-oxo-2H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 88942623 |
| Molecular Formula | C19H19BrFN3O4 |
| Molecular Weight | 452.28 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 6-(4-bromo-2-fluoroanilino)-N-(2-hydroxyethoxy)-3,3-dimethyl-1-oxo-2H-isoindole-5-carboxamide |
| SMILES | CC1(C)NC(=O)c2cc(Nc3ccc(Br)cc3F)c(C(=O)NOCCO)cc21 |
| InChI | InChI=1S/C19H19BrFN3O4/c1-19(2)13-8-12(18(27)24-28-6-5-25)16(9-11(13)17(26)23-19)22-15-4-3-10(20)7-14(15)21/h3-4,7-9,22,25H,5-6H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | KJUBLDBUJBVMHD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|