C17H15FIN3O4 — CID 44545707
6-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-oxo-2,3-dihydroisoindole-5-carboxamide (PubChem CID 44545707) has the molecular formula C17H15FIN3O4 and a molecular weight of 471.23 g/mol. Its IUPAC name is 6-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-oxo-2,3-dihydroisoindole-5-carboxamide.
| Compound Name | 6-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-oxo-2,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 44545707 |
| Molecular Formula | C17H15FIN3O4 |
| Molecular Weight | 471.23 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 6-(2-fluoro-4-iodoanilino)-N-(2-hydroxyethoxy)-1-oxo-2,3-dihydroisoindole-5-carboxamide |
| SMILES | O=C1NCc2cc(C(=O)NOCCO)c(Nc3ccc(I)cc3F)cc21 |
| InChI | InChI=1S/C17H15FIN3O4/c18-13-6-10(19)1-2-14(13)21-15-7-11-9(8-20-16(11)24)5-12(15)17(25)22-26-4-3-23/h1-2,5-7,21,23H,3-4,8H2,(H,20,24)(H,22,25) |
| InChIKey | DZRWYLSCZMVOSS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|