C18H17FIN3O5 — CID 45107546
N-[(2R)-2,3-dihydroxypropoxy]-6-(2-fluoro-4-iodoanilino)-1-oxo-2,3-dihydroisoindole-5-carboxamide (PubChem CID 45107546) has the molecular formula C18H17FIN3O5 and a molecular weight of 501.25 g/mol. Its IUPAC name is N-[(2R)-2,3-dihydroxypropoxy]-6-(2-fluoro-4-iodoanilino)-1-oxo-2,3-dihydroisoindole-5-carboxamide.
| Compound Name | N-[(2R)-2,3-dihydroxypropoxy]-6-(2-fluoro-4-iodoanilino)-1-oxo-2,3-dihydroisoindole-5-carboxamide |
|---|---|
| PubChem CID | 45107546 |
| Molecular Formula | C18H17FIN3O5 |
| Molecular Weight | 501.25 g/mol |
| Exact Mass | 501.02 |
| IUPAC Name | N-[(2R)-2,3-dihydroxypropoxy]-6-(2-fluoro-4-iodoanilino)-1-oxo-2,3-dihydroisoindole-5-carboxamide |
| SMILES | O=C1NCc2cc(C(=O)NOC[C@H](O)CO)c(Nc3ccc(I)cc3F)cc21 |
| InChI | InChI=1S/C18H17FIN3O5/c19-14-4-10(20)1-2-15(14)22-16-5-12-9(6-21-17(12)26)3-13(16)18(27)23-28-8-11(25)7-24/h1-5,11,22,24-25H,6-8H2,(H,21,26)(H,23,27)/t11-/m1/s1 |
| InChIKey | VQFHJDPAZUPGBD-LLVKDONJSA-N |
| XLogP | 1.43 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|