C19H17FINO4 — CID 58277494
6-[(2-fluoro-4-iodophenyl)methyl]-5-[2-(2-hydroxyethoxy)acetyl]-2,3-dihydroisoindol-1-one (PubChem CID 58277494) has the molecular formula C19H17FINO4 and a molecular weight of 469.25 g/mol. Its IUPAC name is 6-[(2-fluoro-4-iodophenyl)methyl]-5-[2-(2-hydroxyethoxy)acetyl]-2,3-dihydroisoindol-1-one.
| Compound Name | 6-[(2-fluoro-4-iodophenyl)methyl]-5-[2-(2-hydroxyethoxy)acetyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 58277494 |
| Molecular Formula | C19H17FINO4 |
| Molecular Weight | 469.25 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | 6-[(2-fluoro-4-iodophenyl)methyl]-5-[2-(2-hydroxyethoxy)acetyl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C(COCCO)c1cc2c(cc1Cc1ccc(I)cc1F)C(=O)NC2 |
| InChI | InChI=1S/C19H17FINO4/c20-17-8-14(21)2-1-11(17)5-12-6-16-13(9-22-19(16)25)7-15(12)18(24)10-26-4-3-23/h1-2,6-8,23H,3-5,9-10H2,(H,22,25) |
| InChIKey | AKUVTBVINZGCSJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.25 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|