C18H19NO3 — CID 123339233
6-benzyl-1-oxo-2,3-dihydroisoindole-5-carboxylic acid;ethane (PubChem CID 123339233) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 6-benzyl-1-oxo-2,3-dihydroisoindole-5-carboxylic acid;ethane.
| Compound Name | 6-benzyl-1-oxo-2,3-dihydroisoindole-5-carboxylic acid;ethane |
|---|---|
| PubChem CID | 123339233 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 6-benzyl-1-oxo-2,3-dihydroisoindole-5-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1cc2c(cc1Cc1ccccc1)C(=O)NC2 |
| InChI | InChI=1S/C16H13NO3.C2H6/c18-15-13-7-11(6-10-4-2-1-3-5-10)14(16(19)20)8-12(13)9-17-15;1-2/h1-5,7-8H,6,9H2,(H,17,18)(H,19,20);1-2H3 |
| InChIKey | NYIBNNZRWJRTDE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |