C19H15F2IN2O3S — CID 152916690
2-(2-ethenoxyethoxy)-1-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,2,3-benzothiadiazol-6-yl]ethanone (PubChem CID 152916690) has the molecular formula C19H15F2IN2O3S and a molecular weight of 516.31 g/mol. Its IUPAC name is 2-(2-ethenoxyethoxy)-1-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,2,3-benzothiadiazol-6-yl]ethanone.
| Compound Name | 2-(2-ethenoxyethoxy)-1-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,2,3-benzothiadiazol-6-yl]ethanone |
|---|---|
| PubChem CID | 152916690 |
| Molecular Formula | C19H15F2IN2O3S |
| Molecular Weight | 516.31 g/mol |
| Exact Mass | 515.98 |
| IUPAC Name | 2-(2-ethenoxyethoxy)-1-[4-fluoro-5-[(2-fluoro-4-iodophenyl)methyl]-1,2,3-benzothiadiazol-6-yl]ethanone |
| SMILES | C=COCCOCC(=O)c1cc2snnc2c(F)c1Cc1ccc(I)cc1F |
| InChI | InChI=1S/C19H15F2IN2O3S/c1-2-26-5-6-27-10-16(25)13-9-17-19(23-24-28-17)18(21)14(13)7-11-3-4-12(22)8-15(11)20/h2-4,8-9H,1,5-7,10H2 |
| InChIKey | UIGQBMXWFVLGEY-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.31 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|