C20H18BrFN2O3 — CID 58374301
1-[4-[(4-bromo-2-fluorophenyl)methyl]-1H-indazol-5-yl]-2-(2-ethenoxyethoxy)ethanone (PubChem CID 58374301) has the molecular formula C20H18BrFN2O3 and a molecular weight of 433.28 g/mol. Its IUPAC name is 1-[4-[(4-bromo-2-fluorophenyl)methyl]-1H-indazol-5-yl]-2-(2-ethenoxyethoxy)ethanone.
| Compound Name | 1-[4-[(4-bromo-2-fluorophenyl)methyl]-1H-indazol-5-yl]-2-(2-ethenoxyethoxy)ethanone |
|---|---|
| PubChem CID | 58374301 |
| Molecular Formula | C20H18BrFN2O3 |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | 1-[4-[(4-bromo-2-fluorophenyl)methyl]-1H-indazol-5-yl]-2-(2-ethenoxyethoxy)ethanone |
| SMILES | C=COCCOCC(=O)c1ccc2[nH]ncc2c1Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C20H18BrFN2O3/c1-2-26-7-8-27-12-20(25)15-5-6-19-17(11-23-24-19)16(15)9-13-3-4-14(21)10-18(13)22/h2-6,10-11H,1,7-9,12H2,(H,23,24) |
| InChIKey | RRGPMNUQIDUUDP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|