C21H19BrClFN2O2 — CID 58324300
1-[6-[(4-bromo-2-chlorophenyl)methyl]-7-fluoro-3-methylbenzimidazol-5-yl]-2-but-3-enoxyethanone (PubChem CID 58324300) has the molecular formula C21H19BrClFN2O2 and a molecular weight of 465.75 g/mol. Its IUPAC name is 1-[6-[(4-bromo-2-chlorophenyl)methyl]-7-fluoro-3-methylbenzimidazol-5-yl]-2-but-3-enoxyethanone.
| Compound Name | 1-[6-[(4-bromo-2-chlorophenyl)methyl]-7-fluoro-3-methylbenzimidazol-5-yl]-2-but-3-enoxyethanone |
|---|---|
| PubChem CID | 58324300 |
| Molecular Formula | C21H19BrClFN2O2 |
| Molecular Weight | 465.75 g/mol |
| Exact Mass | 464.03 |
| IUPAC Name | 1-[6-[(4-bromo-2-chlorophenyl)methyl]-7-fluoro-3-methylbenzimidazol-5-yl]-2-but-3-enoxyethanone |
| SMILES | C=CCCOCC(=O)c1cc2c(ncn2C)c(F)c1Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C21H19BrClFN2O2/c1-3-4-7-28-11-19(27)15-10-18-21(25-12-26(18)2)20(24)16(15)8-13-5-6-14(22)9-17(13)23/h3,5-6,9-10,12H,1,4,7-8,11H2,2H3 |
| InChIKey | IVFHDPWXGLRDNM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.75 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|