C23H24BrClFN3O3 — CID 58324213
1-[6-[(4-bromo-2-chlorophenyl)methyl]-7-fluoro-3-methylbenzimidazol-5-yl]-2-(2-morpholin-4-ylethoxy)ethanone (PubChem CID 58324213) has the molecular formula C23H24BrClFN3O3 and a molecular weight of 524.82 g/mol. Its IUPAC name is 1-[6-[(4-bromo-2-chlorophenyl)methyl]-7-fluoro-3-methylbenzimidazol-5-yl]-2-(2-morpholin-4-ylethoxy)ethanone.
| Compound Name | 1-[6-[(4-bromo-2-chlorophenyl)methyl]-7-fluoro-3-methylbenzimidazol-5-yl]-2-(2-morpholin-4-ylethoxy)ethanone |
|---|---|
| PubChem CID | 58324213 |
| Molecular Formula | C23H24BrClFN3O3 |
| Molecular Weight | 524.82 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 1-[6-[(4-bromo-2-chlorophenyl)methyl]-7-fluoro-3-methylbenzimidazol-5-yl]-2-(2-morpholin-4-ylethoxy)ethanone |
| SMILES | Cn1cnc2c(F)c(Cc3ccc(Br)cc3Cl)c(C(=O)COCCN3CCOCC3)cc21 |
| InChI | InChI=1S/C23H24BrClFN3O3/c1-28-14-27-23-20(28)12-17(21(30)13-32-9-6-29-4-7-31-8-5-29)18(22(23)26)10-15-2-3-16(24)11-19(15)25/h2-3,11-12,14H,4-10,13H2,1H3 |
| InChIKey | KJSVOQAZRKGNOH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.82 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|