C18H16BrF2N3O3 — CID 148792265
6-[(4-bromo-2-fluorophenyl)methyl]-7-fluoro-N-(2-hydroxyethoxy)-3-methylbenzimidazole-5-carboxamide (PubChem CID 148792265) has the molecular formula C18H16BrF2N3O3 and a molecular weight of 440.24 g/mol. Its IUPAC name is 6-[(4-bromo-2-fluorophenyl)methyl]-7-fluoro-N-(2-hydroxyethoxy)-3-methylbenzimidazole-5-carboxamide.
| Compound Name | 6-[(4-bromo-2-fluorophenyl)methyl]-7-fluoro-N-(2-hydroxyethoxy)-3-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 148792265 |
| Molecular Formula | C18H16BrF2N3O3 |
| Molecular Weight | 440.24 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | 6-[(4-bromo-2-fluorophenyl)methyl]-7-fluoro-N-(2-hydroxyethoxy)-3-methylbenzimidazole-5-carboxamide |
| SMILES | Cn1cnc2c(F)c(Cc3ccc(Br)cc3F)c(C(=O)NOCCO)cc21 |
| InChI | InChI=1S/C18H16BrF2N3O3/c1-24-9-22-17-15(24)8-13(18(26)23-27-5-4-25)12(16(17)21)6-10-2-3-11(19)7-14(10)20/h2-3,7-9,25H,4-6H2,1H3,(H,23,26) |
| InChIKey | OMKBRMMKZQSQOY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|