C17H17BBrClFN4O3 — CID 174073898
CID 174073898 (PubChem CID 174073898) has the molecular formula C17H17BBrClFN4O3 and a molecular weight of 470.52 g/mol.
| Compound Name | CID 174073898 |
|---|---|
| PubChem CID | 174073898 |
| Molecular Formula | C17H17BBrClFN4O3 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 469.02 |
| IUPAC Name | — |
| SMILES | [B]=C(Nc1c(C(=O)NOCCO)cc2c(ncn2C)c1F)/C(Cl)=C\C(Br)=C/C |
| InChI | InChI=1S/C17H17BBrClFN4O3/c1-3-9(19)6-11(20)16(18)23-14-10(17(27)24-28-5-4-26)7-12-15(13(14)21)22-8-25(12)2/h3,6-8,23,26H,4-5H2,1-2H3,(H,24,27)/b9-3+,11-6+ |
| InChIKey | MDRMCRTZUDGASL-XNYWHNRVSA-N |
| XLogP | 2.50 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|