C17H13B2BrClFN4O3 — CID 174073919
CID 174073919 (PubChem CID 174073919) has the molecular formula C17H13B2BrClFN4O3 and a molecular weight of 477.30 g/mol.
| Compound Name | CID 174073919 |
|---|---|
| PubChem CID | 174073919 |
| Molecular Formula | C17H13B2BrClFN4O3 |
| Molecular Weight | 477.30 g/mol |
| Exact Mass | 476.00 |
| IUPAC Name | — |
| SMILES | [B]c1cc(Br)cc(Cl)c1Nc1c(C(=O)NOCCO)c([B])c2c(ncn2C)c1F |
| InChI | InChI=1S/C17H13B2BrClFN4O3/c1-26-6-23-15-12(22)14(24-13-8(18)4-7(20)5-9(13)21)10(11(19)16(15)26)17(28)25-29-3-2-27/h4-6,24,27H,2-3H2,1H3,(H,25,28) |
| InChIKey | VYTJMOHMGXEURA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|