C21H21BrClFN4O5 — CID 87668138
[6-(4-bromo-2-chloroanilino)-7-fluoro-3-(oxolan-2-ylmethyl)benzimidazol-5-yl] N-(2-hydroxyethoxy)carbamate (PubChem CID 87668138) has the molecular formula C21H21BrClFN4O5 and a molecular weight of 543.78 g/mol. Its IUPAC name is [6-(4-bromo-2-chloroanilino)-7-fluoro-3-(oxolan-2-ylmethyl)benzimidazol-5-yl] N-(2-hydroxyethoxy)carbamate.
| Compound Name | [6-(4-bromo-2-chloroanilino)-7-fluoro-3-(oxolan-2-ylmethyl)benzimidazol-5-yl] N-(2-hydroxyethoxy)carbamate |
|---|---|
| PubChem CID | 87668138 |
| Molecular Formula | C21H21BrClFN4O5 |
| Molecular Weight | 543.78 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | [6-(4-bromo-2-chloroanilino)-7-fluoro-3-(oxolan-2-ylmethyl)benzimidazol-5-yl] N-(2-hydroxyethoxy)carbamate |
| SMILES | O=C(NOCCO)Oc1cc2c(ncn2CC2CCCO2)c(F)c1Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C21H21BrClFN4O5/c22-12-3-4-15(14(23)8-12)26-20-17(33-21(30)27-32-7-5-29)9-16-19(18(20)24)25-11-28(16)10-13-2-1-6-31-13/h3-4,8-9,11,13,26,29H,1-2,5-7,10H2,(H,27,30) |
| InChIKey | KPYYYJJCXBQXEQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|