C15H18FN3O4 — CID 141214965
2-fluoro-N-(2-hydroxyethoxy)-3-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide (PubChem CID 141214965) has the molecular formula C15H18FN3O4 and a molecular weight of 323.32 g/mol. Its IUPAC name is 2-fluoro-N-(2-hydroxyethoxy)-3-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide.
| Compound Name | 2-fluoro-N-(2-hydroxyethoxy)-3-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 141214965 |
| Molecular Formula | C15H18FN3O4 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-fluoro-N-(2-hydroxyethoxy)-3-(oxolan-2-ylmethyl)benzimidazole-5-carboxamide |
| SMILES | O=C(NOCCO)c1ccc2nc(F)n(CC3CCCO3)c2c1 |
| InChI | InChI=1S/C15H18FN3O4/c16-15-17-12-4-3-10(14(21)18-23-7-5-20)8-13(12)19(15)9-11-2-1-6-22-11/h3-4,8,11,20H,1-2,5-7,9H2,(H,18,21) |
| InChIKey | HBUCLARHDWPHPB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|