C26H28BF3N2O5 — CID 167438664
methyl 3-[[(2S)-oxetan-2-yl]methyl]-2-[[2,3,6-trifluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzimidazole-5-carboxylate (PubChem CID 167438664) has the molecular formula C26H28BF3N2O5 and a molecular weight of 516.33 g/mol. Its IUPAC name is methyl 3-[[(2S)-oxetan-2-yl]methyl]-2-[[2,3,6-trifluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzimidazole-5-carboxylate.
| Compound Name | methyl 3-[[(2S)-oxetan-2-yl]methyl]-2-[[2,3,6-trifluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 167438664 |
| Molecular Formula | C26H28BF3N2O5 |
| Molecular Weight | 516.33 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | methyl 3-[[(2S)-oxetan-2-yl]methyl]-2-[[2,3,6-trifluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2nc(Cc3c(F)cc(B4OC(C)(C)C(C)(C)O4)c(F)c3F)n(C[C@@H]3CCO3)c2c1 |
| InChI | InChI=1S/C26H28BF3N2O5/c1-25(2)26(3,4)37-27(36-25)17-12-18(28)16(22(29)23(17)30)11-21-31-19-7-6-14(24(33)34-5)10-20(19)32(21)13-15-8-9-35-15/h6-7,10,12,15H,8-9,11,13H2,1-5H3/t15-/m0/s1 |
| InChIKey | CGXJFQOSOIPQKA-HNNXBMFYSA-N |
| XLogP | 3.92 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.33 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|