C27H31BF2N2O5 — CID 155627025
ethyl 4-fluoro-2-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate (PubChem CID 155627025) has the molecular formula C27H31BF2N2O5 and a molecular weight of 512.36 g/mol. Its IUPAC name is ethyl 4-fluoro-2-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate.
| Compound Name | ethyl 4-fluoro-2-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 155627025 |
| Molecular Formula | C27H31BF2N2O5 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 512.23 |
| IUPAC Name | ethyl 4-fluoro-2-[[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2nc(Cc3ccc(B4OC(C)(C)C(C)(C)O4)c(F)c3)n(C[C@@H]3CCO3)c2c1F |
| InChI | InChI=1S/C27H31BF2N2O5/c1-6-34-25(33)18-8-10-21-24(23(18)30)32(15-17-11-12-35-17)22(31-21)14-16-7-9-19(20(29)13-16)28-36-26(2,3)27(4,5)37-28/h7-10,13,17H,6,11-12,14-15H2,1-5H3/t17-/m0/s1 |
| InChIKey | MCNAJQPCFCHQIL-KRWDZBQOSA-N |
| XLogP | 4.17 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|