C25H28BFN2O5 — CID 171424264
[2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazol-5-yl] formate (PubChem CID 171424264) has the molecular formula C25H28BFN2O5 and a molecular weight of 466.32 g/mol. Its IUPAC name is [2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazol-5-yl] formate.
| Compound Name | [2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazol-5-yl] formate |
|---|---|
| PubChem CID | 171424264 |
| Molecular Formula | C25H28BFN2O5 |
| Molecular Weight | 466.32 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | [2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-3-[[(2S)-oxetan-2-yl]methyl]benzimidazol-5-yl] formate |
| SMILES | CC1(C)OB(c2ccc(Cc3nc4ccc(OC=O)cc4n3C[C@@H]3CCO3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C25H28BFN2O5/c1-24(2)25(3,4)34-26(33-24)17-6-5-16(20(27)12-17)11-23-28-21-8-7-18(32-15-30)13-22(21)29(23)14-19-9-10-31-19/h5-8,12-13,15,19H,9-11,14H2,1-4H3/t19-/m0/s1 |
| InChIKey | QRBSIHNKPRELDP-IBGZPJMESA-N |
| XLogP | 3.39 |
| TPSA | 71.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|