C27H31BFN3O2 — CID 171424306
2-[1-[[2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-methylbenzimidazol-1-yl]methyl]cyclopropyl]acetonitrile (PubChem CID 171424306) has the molecular formula C27H31BFN3O2 and a molecular weight of 459.37 g/mol. Its IUPAC name is 2-[1-[[2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-methylbenzimidazol-1-yl]methyl]cyclopropyl]acetonitrile.
| Compound Name | 2-[1-[[2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-methylbenzimidazol-1-yl]methyl]cyclopropyl]acetonitrile |
|---|---|
| PubChem CID | 171424306 |
| Molecular Formula | C27H31BFN3O2 |
| Molecular Weight | 459.37 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 2-[1-[[2-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-6-methylbenzimidazol-1-yl]methyl]cyclopropyl]acetonitrile |
| SMILES | Cc1ccc2nc(Cc3ccc(B4OC(C)(C)C(C)(C)O4)cc3F)n(CC3(CC#N)CC3)c2c1 |
| InChI | InChI=1S/C27H31BFN3O2/c1-18-6-9-22-23(14-18)32(17-27(10-11-27)12-13-30)24(31-22)15-19-7-8-20(16-21(19)29)28-33-25(2,3)26(4,5)34-28/h6-9,14,16H,10-12,15,17H2,1-5H3 |
| InChIKey | WYOYZUCMEYMQKT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 60.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|