C22H22BrF2N3O3 — CID 155190558
tert-butyl 2-[(4-bromo-2,5-difluorophenyl)methyl]-3-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-b]pyridine-5-carboxylate (PubChem CID 155190558) has the molecular formula C22H22BrF2N3O3 and a molecular weight of 494.34 g/mol. Its IUPAC name is tert-butyl 2-[(4-bromo-2,5-difluorophenyl)methyl]-3-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-b]pyridine-5-carboxylate.
| Compound Name | tert-butyl 2-[(4-bromo-2,5-difluorophenyl)methyl]-3-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 155190558 |
| Molecular Formula | C22H22BrF2N3O3 |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 493.08 |
| IUPAC Name | tert-butyl 2-[(4-bromo-2,5-difluorophenyl)methyl]-3-[[(2S)-oxetan-2-yl]methyl]imidazo[4,5-b]pyridine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccc2nc(Cc3cc(F)c(Br)cc3F)n(C[C@@H]3CCO3)c2n1 |
| InChI | InChI=1S/C22H22BrF2N3O3/c1-22(2,3)31-21(29)18-5-4-17-20(27-18)28(11-13-6-7-30-13)19(26-17)9-12-8-16(25)14(23)10-15(12)24/h4-5,8,10,13H,6-7,9,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | TZMVUQCELMXJBA-ZDUSSCGKSA-N |
| XLogP | 4.81 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|