C22H22BrF3N2O3 — CID 166088470
tert-butyl 2-[(4-bromo-2,5-difluorophenyl)methyl]-4-fluoro-3-(2-methoxyethyl)benzimidazole-5-carboxylate (PubChem CID 166088470) has the molecular formula C22H22BrF3N2O3 and a molecular weight of 499.33 g/mol. Its IUPAC name is tert-butyl 2-[(4-bromo-2,5-difluorophenyl)methyl]-4-fluoro-3-(2-methoxyethyl)benzimidazole-5-carboxylate.
| Compound Name | tert-butyl 2-[(4-bromo-2,5-difluorophenyl)methyl]-4-fluoro-3-(2-methoxyethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 166088470 |
| Molecular Formula | C22H22BrF3N2O3 |
| Molecular Weight | 499.33 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | tert-butyl 2-[(4-bromo-2,5-difluorophenyl)methyl]-4-fluoro-3-(2-methoxyethyl)benzimidazole-5-carboxylate |
| SMILES | COCCn1c(Cc2cc(F)c(Br)cc2F)nc2ccc(C(=O)OC(C)(C)C)c(F)c21 |
| InChI | InChI=1S/C22H22BrF3N2O3/c1-22(2,3)31-21(29)13-5-6-17-20(19(13)26)28(7-8-30-4)18(27-17)10-12-9-16(25)14(23)11-15(12)24/h5-6,9,11H,7-8,10H2,1-4H3 |
| InChIKey | PZSYOQDXNPPNJI-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.33 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|