C21H26BrN3O3 — CID 156731504
ethane;methyl 2-[(2-amino-4-bromophenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate (PubChem CID 156731504) has the molecular formula C21H26BrN3O3 and a molecular weight of 448.36 g/mol. Its IUPAC name is ethane;methyl 2-[(2-amino-4-bromophenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate.
| Compound Name | ethane;methyl 2-[(2-amino-4-bromophenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 156731504 |
| Molecular Formula | C21H26BrN3O3 |
| Molecular Weight | 448.36 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | ethane;methyl 2-[(2-amino-4-bromophenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate |
| SMILES | CC.COCCn1c(Cc2ccc(Br)cc2N)nc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C19H20BrN3O3.C2H6/c1-25-8-7-23-17-9-13(19(24)26-2)4-6-16(17)22-18(23)10-12-3-5-14(20)11-15(12)21;1-2/h3-6,9,11H,7-8,10,21H2,1-2H3;1-2H3 |
| InChIKey | MTGDNPAIGLCTTJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.36 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|