C39H42BrF3N2O4 — CID 156731120
tert-butyl 2-[[4-[(3Z,5Z,7E)-8-[(4-bromo-2-fluorophenyl)methoxy]-3-methylnona-3,5,7-trien-4-yl]-2,5-difluorophenyl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate (PubChem CID 156731120) has the molecular formula C39H42BrF3N2O4 and a molecular weight of 739.67 g/mol. Its IUPAC name is tert-butyl 2-[[4-[(3Z,5Z,7E)-8-[(4-bromo-2-fluorophenyl)methoxy]-3-methylnona-3,5,7-trien-4-yl]-2,5-difluorophenyl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate.
| Compound Name | tert-butyl 2-[[4-[(3Z,5Z,7E)-8-[(4-bromo-2-fluorophenyl)methoxy]-3-methylnona-3,5,7-trien-4-yl]-2,5-difluorophenyl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 156731120 |
| Molecular Formula | C39H42BrF3N2O4 |
| Molecular Weight | 739.67 g/mol |
| Exact Mass | 738.23 |
| IUPAC Name | tert-butyl 2-[[4-[(3Z,5Z,7E)-8-[(4-bromo-2-fluorophenyl)methoxy]-3-methylnona-3,5,7-trien-4-yl]-2,5-difluorophenyl]methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate |
| SMILES | CC/C(C)=C(/C=C\C=C(/C)OCc1ccc(Br)cc1F)c1cc(F)c(Cc2nc3ccc(C(=O)OC(C)(C)C)cc3n2CCOC)cc1F |
| InChI | InChI=1S/C39H42BrF3N2O4/c1-8-24(2)30(11-9-10-25(3)48-23-27-12-14-29(40)21-32(27)41)31-22-33(42)28(18-34(31)43)20-37-44-35-15-13-26(38(46)49-39(4,5)6)19-36(35)45(37)16-17-47-7/h9-15,18-19,21-22H,8,16-17,20,23H2,1-7H3/b11-9-,25-10+,30-24- |
| InChIKey | KKETVXLLYJMRIQ-SKBFHLMTSA-N |
| XLogP | 10.27 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.67 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|