C19H16BrF3N2O3 — CID 171472598
methyl 2-[(4-bromo-2,3,6-trifluorophenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate (PubChem CID 171472598) has the molecular formula C19H16BrF3N2O3 and a molecular weight of 457.25 g/mol. Its IUPAC name is methyl 2-[(4-bromo-2,3,6-trifluorophenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate.
| Compound Name | methyl 2-[(4-bromo-2,3,6-trifluorophenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 171472598 |
| Molecular Formula | C19H16BrF3N2O3 |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | methyl 2-[(4-bromo-2,3,6-trifluorophenyl)methyl]-3-(2-methoxyethyl)benzimidazole-5-carboxylate |
| SMILES | COCCn1c(Cc2c(F)cc(Br)c(F)c2F)nc2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C19H16BrF3N2O3/c1-27-6-5-25-15-7-10(19(26)28-2)3-4-14(15)24-16(25)8-11-13(21)9-12(20)18(23)17(11)22/h3-4,7,9H,5-6,8H2,1-2H3 |
| InChIKey | OWBGMLDUNGTALH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|