C22H30FN5O2 — CID 142991641
6-(2,4-dimethylanilino)-7-fluoro-3-methyl-N-[2-(methylamino)ethoxy]benzimidazole-5-carboxamide;ethane (PubChem CID 142991641) has the molecular formula C22H30FN5O2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 6-(2,4-dimethylanilino)-7-fluoro-3-methyl-N-[2-(methylamino)ethoxy]benzimidazole-5-carboxamide;ethane.
| Compound Name | 6-(2,4-dimethylanilino)-7-fluoro-3-methyl-N-[2-(methylamino)ethoxy]benzimidazole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 142991641 |
| Molecular Formula | C22H30FN5O2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 6-(2,4-dimethylanilino)-7-fluoro-3-methyl-N-[2-(methylamino)ethoxy]benzimidazole-5-carboxamide;ethane |
| SMILES | CC.CNCCONC(=O)c1cc2c(ncn2C)c(F)c1Nc1ccc(C)cc1C |
| InChI | InChI=1S/C20H24FN5O2.C2H6/c1-12-5-6-15(13(2)9-12)24-18-14(20(27)25-28-8-7-22-3)10-16-19(17(18)21)23-11-26(16)4;1-2/h5-6,9-11,22,24H,7-8H2,1-4H3,(H,25,27);1-2H3 |
| InChIKey | SJCWTKPRMLYSFU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|