C21H26F2N4O2 — CID 142991585
ethane;7-fluoro-6-(2-fluoro-4-methylanilino)-N-(3-hydroxypropyl)-3-methylbenzimidazole-5-carboxamide (PubChem CID 142991585) has the molecular formula C21H26F2N4O2 and a molecular weight of 404.46 g/mol. Its IUPAC name is ethane;7-fluoro-6-(2-fluoro-4-methylanilino)-N-(3-hydroxypropyl)-3-methylbenzimidazole-5-carboxamide.
| Compound Name | ethane;7-fluoro-6-(2-fluoro-4-methylanilino)-N-(3-hydroxypropyl)-3-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 142991585 |
| Molecular Formula | C21H26F2N4O2 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | ethane;7-fluoro-6-(2-fluoro-4-methylanilino)-N-(3-hydroxypropyl)-3-methylbenzimidazole-5-carboxamide |
| SMILES | CC.Cc1ccc(Nc2c(C(=O)NCCCO)cc3c(ncn3C)c2F)c(F)c1 |
| InChI | InChI=1S/C19H20F2N4O2.C2H6/c1-11-4-5-14(13(20)8-11)24-17-12(19(27)22-6-3-7-26)9-15-18(16(17)21)23-10-25(15)2;1-2/h4-5,8-10,24,26H,3,6-7H2,1-2H3,(H,22,27);1-2H3 |
| InChIKey | RUFNJWZWCBWYMI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|