C20H18F2N4O2 — CID 58781105
6-(4-ethynyl-2-fluoroanilino)-7-fluoro-N-(3-hydroxypropyl)-3-methylbenzimidazole-5-carboxamide (PubChem CID 58781105) has the molecular formula C20H18F2N4O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is 6-(4-ethynyl-2-fluoroanilino)-7-fluoro-N-(3-hydroxypropyl)-3-methylbenzimidazole-5-carboxamide.
| Compound Name | 6-(4-ethynyl-2-fluoroanilino)-7-fluoro-N-(3-hydroxypropyl)-3-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 58781105 |
| Molecular Formula | C20H18F2N4O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 6-(4-ethynyl-2-fluoroanilino)-7-fluoro-N-(3-hydroxypropyl)-3-methylbenzimidazole-5-carboxamide |
| SMILES | C#Cc1ccc(Nc2c(C(=O)NCCCO)cc3c(ncn3C)c2F)c(F)c1 |
| InChI | InChI=1S/C20H18F2N4O2/c1-3-12-5-6-15(14(21)9-12)25-18-13(20(28)23-7-4-8-27)10-16-19(17(18)22)24-11-26(16)2/h1,5-6,9-11,25,27H,4,7-8H2,2H3,(H,23,28) |
| InChIKey | MNJNGJYNVIXGLT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|