C29H38FN5O2 — CID 89127377
N-(cyclopropylmethoxy)-6-(2,4-dimethylanilino)-7-fluoro-3-(4-piperidin-1-ylbutyl)benzimidazole-5-carboxamide (PubChem CID 89127377) has the molecular formula C29H38FN5O2 and a molecular weight of 507.65 g/mol. Its IUPAC name is N-(cyclopropylmethoxy)-6-(2,4-dimethylanilino)-7-fluoro-3-(4-piperidin-1-ylbutyl)benzimidazole-5-carboxamide.
| Compound Name | N-(cyclopropylmethoxy)-6-(2,4-dimethylanilino)-7-fluoro-3-(4-piperidin-1-ylbutyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 89127377 |
| Molecular Formula | C29H38FN5O2 |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | N-(cyclopropylmethoxy)-6-(2,4-dimethylanilino)-7-fluoro-3-(4-piperidin-1-ylbutyl)benzimidazole-5-carboxamide |
| SMILES | Cc1ccc(Nc2c(C(=O)NOCC3CC3)cc3c(ncn3CCCCN3CCCCC3)c2F)c(C)c1 |
| InChI | InChI=1S/C29H38FN5O2/c1-20-8-11-24(21(2)16-20)32-27-23(29(36)33-37-18-22-9-10-22)17-25-28(26(27)30)31-19-35(25)15-7-6-14-34-12-4-3-5-13-34/h8,11,16-17,19,22,32H,3-7,9-10,12-15,18H2,1-2H3,(H,33,36) |
| InChIKey | QIDAQMNPDHSJOB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|