C23H22BrF2N3O3 — CID 58360778
5-[2-(3-aminopropoxy)acetyl]-4-[(4-bromo-2-fluorophenyl)methyl]-3-fluoro-1-(pyridin-3-ylmethyl)pyridin-2-one (PubChem CID 58360778) has the molecular formula C23H22BrF2N3O3 and a molecular weight of 506.35 g/mol. Its IUPAC name is 5-[2-(3-aminopropoxy)acetyl]-4-[(4-bromo-2-fluorophenyl)methyl]-3-fluoro-1-(pyridin-3-ylmethyl)pyridin-2-one.
| Compound Name | 5-[2-(3-aminopropoxy)acetyl]-4-[(4-bromo-2-fluorophenyl)methyl]-3-fluoro-1-(pyridin-3-ylmethyl)pyridin-2-one |
|---|---|
| PubChem CID | 58360778 |
| Molecular Formula | C23H22BrF2N3O3 |
| Molecular Weight | 506.35 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | 5-[2-(3-aminopropoxy)acetyl]-4-[(4-bromo-2-fluorophenyl)methyl]-3-fluoro-1-(pyridin-3-ylmethyl)pyridin-2-one |
| SMILES | NCCCOCC(=O)c1cn(Cc2cccnc2)c(=O)c(F)c1Cc1ccc(Br)cc1F |
| InChI | InChI=1S/C23H22BrF2N3O3/c24-17-5-4-16(20(25)10-17)9-18-19(21(30)14-32-8-2-6-27)13-29(23(31)22(18)26)12-15-3-1-7-28-11-15/h1,3-5,7,10-11,13H,2,6,8-9,12,14,27H2 |
| InChIKey | WHGIUEPFXJJKPQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|