About pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate
pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate (PubChem CID 78781804) has the molecular formula C13H9BrFNO2
and a molecular weight of 310.12 g/mol. Its IUPAC name is pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate |
| PubChem CID | 78781804 |
| Molecular Formula | C13H9BrFNO2 |
| Molecular Weight | 310.12 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate |
| SMILES | O=C(OCc1cccnc1)c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H9BrFNO2/c14-10-3-4-12(15)11(6-10)13(17)18-8-9-2-1-5-16-7-9/h1-7H,8H2 |
| InChIKey | IHFNVIDGYWDKEC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.12 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate?
The IUPAC name of pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate (CID 78781804) is pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate.
What is the SMILES notation for pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate?
The canonical SMILES for pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate is O=C(OCc1cccnc1)c1cc(Br)ccc1F.
What is the InChIKey of pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate?
The InChIKey is IHFNVIDGYWDKEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrFNO2/c14-10-3-4-12(15)11(6-10)13(17)18-8-9-2-1-5-16-7-9/h1-7H,8H2.
What are the key properties of pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate?
pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate has a molecular weight of 310.12 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl 5-bromo-2-fluorobenzoate is sourced from PubChem (CID 78781804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).