About pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate
pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate (PubChem CID 71976383) has the molecular formula C13H9BrN2O4
and a molecular weight of 337.13 g/mol. Its IUPAC name is pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate.
Molecular Properties
| Compound Name | pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate |
| PubChem CID | 71976383 |
| Molecular Formula | C13H9BrN2O4 |
| Molecular Weight | 337.13 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate |
| SMILES | O=C(OCc1cccnc1)c1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H9BrN2O4/c14-10-3-4-11(12(6-10)16(18)19)13(17)20-8-9-2-1-5-15-7-9/h1-7H,8H2 |
| InChIKey | LYOFFKPXYNUATR-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.13 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate?
The IUPAC name of pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate (CID 71976383) is pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate.
What is the SMILES notation for pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate?
The canonical SMILES for pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate is O=C(OCc1cccnc1)c1ccc(Br)cc1[N+](=O)[O-].
What is the InChIKey of pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate?
The InChIKey is LYOFFKPXYNUATR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrN2O4/c14-10-3-4-11(12(6-10)16(18)19)13(17)20-8-9-2-1-5-15-7-9/h1-7H,8H2.
What are the key properties of pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate?
pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate has a molecular weight of 337.13 g/mol, XLogP of 3.11, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-3-ylmethyl 4-bromo-2-nitrobenzoate is sourced from PubChem (CID 71976383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).