About benzyl 2-nitro-4-phenylmethoxybenzoate;ethane
benzyl 2-nitro-4-phenylmethoxybenzoate;ethane (PubChem CID 91011347) has the molecular formula C25H29NO5
and a molecular weight of 423.51 g/mol. Its IUPAC name is benzyl 2-nitro-4-phenylmethoxybenzoate;ethane.
Molecular Properties
| Compound Name | benzyl 2-nitro-4-phenylmethoxybenzoate;ethane |
| PubChem CID | 91011347 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | benzyl 2-nitro-4-phenylmethoxybenzoate;ethane |
| SMILES | CC.CC.O=C(OCc1ccccc1)c1ccc(OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17NO5.2C2H6/c23-21(27-15-17-9-5-2-6-10-17)19-12-11-18(13-20(19)22(24)25)26-14-16-7-3-1-4-8-16;2*1-2/h1-13H,14-15H2;2*1-2H3 |
| InChIKey | SKGKQELCCDCBOH-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-nitro-4-phenylmethoxybenzoate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-nitro-4-phenylmethoxybenzoate;ethane?
The IUPAC name of benzyl 2-nitro-4-phenylmethoxybenzoate;ethane (CID 91011347) is benzyl 2-nitro-4-phenylmethoxybenzoate;ethane.
What is the SMILES notation for benzyl 2-nitro-4-phenylmethoxybenzoate;ethane?
The canonical SMILES for benzyl 2-nitro-4-phenylmethoxybenzoate;ethane is CC.CC.O=C(OCc1ccccc1)c1ccc(OCc2ccccc2)cc1[N+](=O)[O-].
What is the InChIKey of benzyl 2-nitro-4-phenylmethoxybenzoate;ethane?
The InChIKey is SKGKQELCCDCBOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO5.2C2H6/c23-21(27-15-17-9-5-2-6-10-17)19-12-11-18(13-20(19)22(24)25)26-14-16-7-3-1-4-8-16;2*1-2/h1-13H,14-15H2;2*1-2H3.
What are the key properties of benzyl 2-nitro-4-phenylmethoxybenzoate;ethane?
benzyl 2-nitro-4-phenylmethoxybenzoate;ethane has a molecular weight of 423.51 g/mol, XLogP of 6.58, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-nitro-4-phenylmethoxybenzoate;ethane is sourced from PubChem (CID 91011347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).